EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O4 |
| Net Charge | 0 |
| Average Mass | 432.645 |
| Monoisotopic Mass | 432.32396 |
| SMILES | [H][C@@]12CCC3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC(=O)[C@]1([H])[C@H](C)C(=O)CC[C@H](C)CO |
| InChI | InChI=1S/C27H44O4/c1-16(15-28)5-8-23(30)17(2)25-24(31)14-22-20-7-6-18-13-19(29)9-11-26(18,3)21(20)10-12-27(22,25)4/h16-22,25,28-29H,5-15H2,1-4H3/t16-,17+,18?,19-,20+,21-,22-,25-,26-,27-/m0/s1 |
| InChIKey | WUCJZZPXANOCFR-MRODEFQISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum tuberosum (ncbitaxon:4113) | - | DOI (10.1016/S0031-9422(00)89267-5) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. food component A physiological role played by any substance that is distributed in foodstuffs. It includes materials derived from plants or animals, such as vitamins or minerals, as well as environmental contaminants. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| barogenin (CHEBI:86509) has role food component (CHEBI:78295) |
| barogenin (CHEBI:86509) has role plant metabolite (CHEBI:76924) |
| barogenin (CHEBI:86509) is a 16-oxo steroid (CHEBI:47786) |
| barogenin (CHEBI:86509) is a 26-hydroxy steroid (CHEBI:36852) |
| barogenin (CHEBI:86509) is a 3β-hydroxy steroid (CHEBI:36836) |
| barogenin (CHEBI:86509) is a cholestanoid (CHEBI:50401) |
| IUPAC Name |
|---|
| (25S)-3β,26-dihydroxycholest-5-ene-16,22-dione |
| Manual Xrefs | Databases |
|---|---|
| HMDB0034403 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2187990 | Reaxys |