EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20F5N3O3 |
| Net Charge | 0 |
| Average Mass | 469.410 |
| Monoisotopic Mass | 469.14248 |
| SMILES | CC(C)(C(=O)NCC(F)(F)C(F)(F)F)C(=O)N[C@@H]1C(=O)Nc2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C22H20F5N3O3/c1-20(2,18(32)28-11-21(23,24)22(25,26)27)19(33)30-16-14-9-4-3-7-12(14)13-8-5-6-10-15(13)29-17(16)31/h3-10,16H,11H2,1-2H3,(H,28,32)(H,29,31)(H,30,33)/t16-/m0/s1 |
| InChIKey | OJPLJFIFUQPSJR-INIZCTEOSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.4.23.46 (memapsin 2) inhibitor An EC 3.4.23.* (aspartic endopeptidase) inhibitor that interferes with the activity of memapsin 2 (EC 3.4.23.46). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| RO4929097 (CHEBI:86474) has role antineoplastic agent (CHEBI:35610) |
| RO4929097 (CHEBI:86474) has role EC 3.4.23.46 (memapsin 2) inhibitor (CHEBI:74925) |
| RO4929097 (CHEBI:86474) is a dibenzoazepine (CHEBI:47804) |
| RO4929097 (CHEBI:86474) is a dicarboxylic acid diamide (CHEBI:35779) |
| RO4929097 (CHEBI:86474) is a lactam (CHEBI:24995) |
| RO4929097 (CHEBI:86474) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| 2,2-dimethyl-N1-[(7S)-6-oxo-6,7-dihydro-5H-dibenzo[b,d]azepin-7-yl]-N3-(2,2,3,3,3-pentafluoropropyl)propanediamide |
| Synonyms | Source |
|---|---|
| rg-4733 | ChEMBL |
| Rg 4733 | ChEMBL |
| Rg-4733 | ChEMBL |
| Ro 4929097 | ChemIDplus |
| Ro4929097 | ChEMBL |
| RO-4929097 | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| LSM-42762 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12194848 | Reaxys |
| CAS:847925-91-1 | ChemIDplus |
| Citations |
|---|