EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H8O5 |
| Net Charge | 0 |
| Average Mass | 220.180 |
| Monoisotopic Mass | 220.03717 |
| SMILES | O=c1c(O)cccc2cc(O)c(O)c(O)c12 |
| InChI | InChI=1S/C11H8O5/c12-6-3-1-2-5-4-7(13)10(15)11(16)8(5)9(6)14/h1-4,13,15-16H,(H,12,14) |
| InChIKey | WDGFFVCWBZVLCE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | EC 1.17.3.2 (xanthine oxidase) inhibitor An EC 1.17.3.* (oxidoreductase acting on CH or CH2 with oxygen as acceptor) inhibitor that interferes with the action of xanthine oxidase (EC 1.17.3.2). antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | protective agent Synthetic or natural substance which is given to prevent a disease or disorder or are used in the process of treating a disease or injury due to a poisonous agent. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| purpurogallin (CHEBI:8647) has parent hydride 5H-benzocycloheptene (CHEBI:37513) |
| purpurogallin (CHEBI:8647) has role antibacterial agent (CHEBI:33282) |
| purpurogallin (CHEBI:8647) has role antioxidant (CHEBI:22586) |
| purpurogallin (CHEBI:8647) has role EC 1.17.3.2 (xanthine oxidase) inhibitor (CHEBI:35634) |
| purpurogallin (CHEBI:8647) has role protective agent (CHEBI:50267) |
| purpurogallin (CHEBI:8647) is a cyclic ketone (CHEBI:3992) |
| purpurogallin (CHEBI:8647) is a phenols (CHEBI:33853) |
| purpurogallin (CHEBI:8647) is a tetrol (CHEBI:33573) |
| IUPAC Name |
|---|
| 2,3,4,6-tetrahydroxy-5H-benzo[7]annulen-5-one |
| Synonyms | Source |
|---|---|
| 2,3,4,6-tetrahydroxy-5H-benzocycloheptene-5-one | ChemIDplus |
| 2,3,4,6-tetrahydroxybenzocyclohepten-5-one | ChemIDplus |
| Purpurogallin | KEGG COMPOUND |
| purpurogalline | ChemIDplus |
| Citations |
|---|