EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26N5O9PS2 |
| Net Charge | 0 |
| Average Mass | 551.540 |
| Monoisotopic Mass | 551.09096 |
| SMILES | Nc1nc(=O)c2ncn([C@@H]3O[C@H](COP(=O)(O)OC(=O)CCCC[C@@H]4CCSS4)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C18H26N5O9PS2/c19-18-21-15-12(16(27)22-18)20-8-23(15)17-14(26)13(25)10(31-17)7-30-33(28,29)32-11(24)4-2-1-3-9-5-6-34-35-9/h8-10,13-14,17,25-26H,1-7H2,(H,28,29)(H3,19,21,22,27)/t9-,10-,13-,14-,17-/m1/s1 |
| InChIKey | CBFBRENOWPXOON-GDHWZLSQSA-N |
| Roles Classification |
|---|
| Biological Role: | mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-lipoyl-GMP (CHEBI:86459) has functional parent (R)-lipoic acid (CHEBI:30314) |
| (R)-lipoyl-GMP (CHEBI:86459) has functional parent guanosine 5'-monophosphate (CHEBI:17345) |
| (R)-lipoyl-GMP (CHEBI:86459) has role mammalian metabolite (CHEBI:75768) |
| (R)-lipoyl-GMP (CHEBI:86459) is a acyclic mixed acid anhydride (CHEBI:37787) |
| (R)-lipoyl-GMP (CHEBI:86459) is a dithiolanes (CHEBI:39192) |
| (R)-lipoyl-GMP (CHEBI:86459) is a purine ribonucleoside 5'-monophosphate (CHEBI:37021) |
| (R)-lipoyl-GMP (CHEBI:86459) is conjugate acid of (R)-lipoyl-GMP(1−) (CHEBI:86460) |
| Incoming Relation(s) |
| (R)-lipoyl-GMP(1−) (CHEBI:86460) is conjugate base of (R)-lipoyl-GMP (CHEBI:86459) |
| IUPAC Name |
|---|
| 5'-O-[({5-[(3R)-1,2-dithiolan-3-yl]pentanoyl}oxy)(hydroxy)phosphoryl]guanosine |
| Synonym | Source |
|---|---|
| (R)-lipoyl adenylate | ChEBI |
| Citations |
|---|