EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:8645 - purpurin
| Formula | C14H8O5 |
| Net Charge | 0 |
| Average Mass | 256.213 |
| Monoisotopic Mass | 256.03717 |
| SMILES | O=C1c2ccccc2C(=O)c2c(O)c(O)cc(O)c21 |
| InChI | InChI=1S/C14H8O5/c15-8-5-9(16)14(19)11-10(8)12(17)6-3-1-2-4-7(6)13(11)18/h1-5,15-16,19H |
| InChIKey | BBNQQADTFFCFGB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. |
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| purpurin (CHEBI:8645) has role biological pigment (CHEBI:26130) |
| purpurin (CHEBI:8645) has role histological dye (CHEBI:77178) |
| purpurin (CHEBI:8645) has role plant metabolite (CHEBI:76924) |
| purpurin (CHEBI:8645) is a trihydroxyanthraquinone (CHEBI:37488) |
| IUPAC Name |
|---|
| 1,2,4-trihydroxyanthracene-9,10-dione |
| Synonyms | Source |
|---|---|
| 1,2,4-trihydroxy-9,10-anthracenedione | ChemIDplus |
| 1,2,4-trihydroxy-9,10-anthraquinone | IUPAC |
| 1,2,4-trihydroxyanthra-9,10-quinone | NIST Chemistry WebBook |
| 1,2,4-Trihydroxyanthrachinon | NIST Chemistry WebBook |
| 1,2,4-trihydroxyanthraquinone | ChemIDplus |
| Alizarin purpurin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 1,2,4-Trihydroxyanthraquinone | Wikipedia |
| C00002857 | KNApSAcK |
| C10395 | KEGG COMPOUND |
| CN101659793 | Patent |
| Citations |
|---|