EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O4 |
| Net Charge | 0 |
| Average Mass | 432.645 |
| Monoisotopic Mass | 432.32396 |
| SMILES | [H][C@@]12CC=C3[C@@H](O)[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)CCC[C@@H](C)C(=O)O |
| InChI | InChI=1S/C27H44O4/c1-16(6-5-7-17(2)25(30)31)19-10-11-20-18-8-9-22-24(29)23(28)13-15-27(22,4)21(18)12-14-26(19,20)3/h9,16-21,23-24,28-29H,5-8,10-15H2,1-4H3,(H,30,31)/t16-,17-,18+,19-,20+,21+,23+,24-,26-,27-/m1/s1 |
| InChIKey | YKGKKDOYGJEANO-ZOQSZFPJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (12077124) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (25R)-3β,4β-dihydroxycholest-5-en-26-oic acid (CHEBI:86434) has role human xenobiotic metabolite (CHEBI:76967) |
| (25R)-3β,4β-dihydroxycholest-5-en-26-oic acid (CHEBI:86434) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| (25R)-3β,4β-dihydroxycholest-5-en-26-oic acid (CHEBI:86434) is a 3β-sterol (CHEBI:35348) |
| (25R)-3β,4β-dihydroxycholest-5-en-26-oic acid (CHEBI:86434) is a 4-hydroxy steroid (CHEBI:62846) |
| (25R)-3β,4β-dihydroxycholest-5-en-26-oic acid (CHEBI:86434) is a cholestanoid (CHEBI:50401) |
| (25R)-3β,4β-dihydroxycholest-5-en-26-oic acid (CHEBI:86434) is a monocarboxylic acid (CHEBI:25384) |
| (25R)-3β,4β-dihydroxycholest-5-en-26-oic acid (CHEBI:86434) is a oxysterol (CHEBI:53030) |
| (25R)-3β,4β-dihydroxycholest-5-en-26-oic acid (CHEBI:86434) is a steroid acid (CHEBI:47891) |
| (25R)-3β,4β-dihydroxycholest-5-en-26-oic acid (CHEBI:86434) is conjugate acid of (25R)-3β,4β-dihydroxycholest-5-en-26-oate(1−) (CHEBI:86116) |
| Incoming Relation(s) |
| (25R)-3β,4β-dihydroxycholest-5-en-26-oate(1−) (CHEBI:86116) is conjugate base of (25R)-3β,4β-dihydroxycholest-5-en-26-oic acid (CHEBI:86434) |
| IUPAC Name |
|---|
| (3β,4β,25R)-3,4-dihydroxycholest-5-en-26-oic acid |
| Citations |
|---|