EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H48O2 |
| Net Charge | 0 |
| Average Mass | 392.668 |
| Monoisotopic Mass | 392.36543 |
| SMILES | CCCCCCCCCCCCCCCC/C=C\CC/C=C\CCCC(=O)O |
| InChI | InChI=1S/C26H48O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26(27)28/h17-18,21-22H,2-16,19-20,23-25H2,1H3,(H,27,28)/b18-17-,22-21- |
| InChIKey | IEXIHWCBQMQDHC-BJVJUIIASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5Z,9Z)-5,9-hexacosadienoic acid (CHEBI:86419) is a olefinic fatty acid (CHEBI:53339) |
| (5Z,9Z)-5,9-hexacosadienoic acid (CHEBI:86419) is a polyunsaturated fatty acid (CHEBI:26208) |
| (5Z,9Z)-5,9-hexacosadienoic acid (CHEBI:86419) is a straight-chain fatty acid (CHEBI:59202) |
| (5Z,9Z)-5,9-hexacosadienoic acid (CHEBI:86419) is a very long-chain fatty acid (CHEBI:27283) |
| Incoming Relation(s) |
| 1-hexadecanoyl-2-[(5Z,9Z)-hexacosadienoyl]-sn-glycero-3-phosphocholine (CHEBI:86418) has functional parent (5Z,9Z)-5,9-hexacosadienoic acid (CHEBI:86419) |
| IUPAC Name |
|---|
| (5Z,9Z)-5,9-hexacosadienoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2287412 | Reaxys |