EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10NO5P |
| Net Charge | -2 |
| Average Mass | 207.122 |
| Monoisotopic Mass | 207.03076 |
| SMILES | CC(=O)N[C@@H](CC[PH](=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C6H12NO5P/c1-4(8)7-5(6(9)10)2-3-13(11)12/h5,13H,2-3H2,1H3,(H,7,8)(H,9,10)(H,11,12)/p-2/t5-/m0/s1 |
| InChIKey | VMEBCHDZEJWXIU-YFKPBYRVSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-Acetyldemethylphosphinothricinate (2-) (CHEBI:86401) is a organic molecular entity (CHEBI:50860) |
| N-Acetyldemethylphosphinothricinate (2-) (CHEBI:86401) is conjugate base of N-Acetyldemethylphosphinothricin (CHEBI:81405) |
| Incoming Relation(s) |
| N-Acetyldemethylphosphinothricin (CHEBI:81405) is conjugate acid of N-Acetyldemethylphosphinothricinate (2-) (CHEBI:86401) |
| UniProt Name | Source |
|---|---|
| N-acetyl-demethyl-L-phosphinothricin | UniProt |
| Citations |
|---|