EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:86396 - monomethyl glutaric acid
| Formula | C6H10O4 |
| Net Charge | 0 |
| Average Mass | 146.142 |
| Monoisotopic Mass | 146.05791 |
| SMILES | COC(=O)CCCC(=O)O |
| InChI | InChI=1S/C6H10O4/c1-10-6(9)4-2-3-5(7)8/h2-4H2,1H3,(H,7,8) |
| InChIKey | IBMRTYCHDPMBFN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | PubMed (24023812) | ||
| urine (BTO:0001419) | MetaboLights (MTBLS101) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monomethyl glutaric acid (CHEBI:86396) has functional parent glutaric acid (CHEBI:17859) |
| monomethyl glutaric acid (CHEBI:86396) has role human urinary metabolite (CHEBI:84087) |
| monomethyl glutaric acid (CHEBI:86396) is a dicarboxylic acid monoester (CHEBI:36244) |
| IUPAC Name |
|---|
| 5-methoxy-5-oxopentanoic acid |
| Synonyms | Source |
|---|---|
| 4-(methoxycarbonyl)butyric acid | ChemIDplus |
| monomethyl glutarate | ChemIDplus |
| 4-methoxycarbonylbutanoic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000858 | HMDB |
| Citations |
|---|