EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H4O4 |
| Net Charge | 0 |
| Average Mass | 128.083 |
| Monoisotopic Mass | 128.01096 |
| SMILES | O=C(O)c1ccc(O)o1 |
| InChI | InChI=1S/C5H4O4/c6-4-2-1-3(9-4)5(7)8/h1-2,6H,(H,7,8) |
| InChIKey | JVUTYZQGCHCOPB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (17439666) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxyfuran-2-carboxylic acid (CHEBI:86395) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| 5-hydroxyfuran-2-carboxylic acid (CHEBI:86395) is a furans (CHEBI:24129) |
| 5-hydroxyfuran-2-carboxylic acid (CHEBI:86395) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| IUPAC Name |
|---|
| 5-hydroxyfuran-2-carboxylic acid |
| Citations |
|---|