EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10N3O2 |
| Net Charge | -1 |
| Average Mass | 144.154 |
| Monoisotopic Mass | 144.07785 |
| SMILES | N=C(N)NCCCC(=O)[O-] |
| InChI | InChI=1S/C5H11N3O2/c6-5(7)8-3-1-2-4(9)10/h1-3H2,(H,9,10)(H4,6,7,8)/p-1 |
| InChIKey | TUHVEAJXIMEOSA-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Schizosaccharomyces pombe (ncbitaxon:4896) | - | DOI (10.3390/metabo3041118) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-guanidinobutanoate (CHEBI:86392) has role fungal metabolite (CHEBI:76946) |
| 4-guanidinobutanoate (CHEBI:86392) is a monocarboxylic acid anion (CHEBI:35757) |
| 4-guanidinobutanoate (CHEBI:86392) is conjugate base of 4-guanidinobutanoic acid (CHEBI:15728) |
| Incoming Relation(s) |
| 4-guanidinobutanoic acid (CHEBI:15728) is conjugate acid of 4-guanidinobutanoate (CHEBI:86392) |
| IUPAC Name |
|---|
| 4-carbamimidamidobutanoate |