EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30O5 |
| Net Charge | 0 |
| Average Mass | 362.466 |
| Monoisotopic Mass | 362.20932 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@]4([H])CC[C@]([H])(C(=O)CO)[C@@]4(C=O)C[C@H](O)[C@]3([H])[C@@]1(C)CCC(=O)C2 |
| InChI | InChI=1S/C21H30O5/c1-20-7-6-13(24)8-12(20)2-3-14-15-4-5-16(18(26)10-22)21(15,11-23)9-17(25)19(14)20/h11-12,14-17,19,22,25H,2-10H2,1H3/t12-,14+,15+,16-,17+,19-,20+,21-/m1/s1 |
| InChIKey | IIBOWSHDTFRYKU-HLQMJBJHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (21255593) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5β-dihydroaldosterone (CHEBI:86389) has functional parent aldosterone (CHEBI:27584) |
| 5β-dihydroaldosterone (CHEBI:86389) has parent hydride pregnane (CHEBI:8386) |
| 5β-dihydroaldosterone (CHEBI:86389) has role human xenobiotic metabolite (CHEBI:76967) |
| 5β-dihydroaldosterone (CHEBI:86389) has role mouse metabolite (CHEBI:75771) |
| 5β-dihydroaldosterone (CHEBI:86389) is a 11β-hydroxy steroid (CHEBI:35346) |
| 5β-dihydroaldosterone (CHEBI:86389) is a 18-oxo steroid (CHEBI:36887) |
| 5β-dihydroaldosterone (CHEBI:86389) is a 20-oxo steroid (CHEBI:36885) |
| 5β-dihydroaldosterone (CHEBI:86389) is a 3-oxo-5β-steroid (CHEBI:1624) |
| 5β-dihydroaldosterone (CHEBI:86389) is a primary α-hydroxy ketone (CHEBI:139590) |
| 5β-dihydroaldosterone (CHEBI:86389) is a steroid aldehyde (CHEBI:131565) |
| IUPAC Name |
|---|
| (5β,11β)-11,21-dihydroxy-3,20-dioxopregnan-18-al |
| Synonyms | Source |
|---|---|
| 11beta,21-Dihydroxy-3,20-oxo-5beta-pregnan-18-al | KEGG COMPOUND |
| 11β,21-dihydroxy-3,20-oxo-5β-pregnan-18-al | ChEBI |
| 5β-dihydroaldosterone | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 5β-dihydroaldosterone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C05473 | KEGG COMPOUND |
| HMDB0006754 | HMDB |
| LMST02030187 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5303791 | Reaxys |
| Citations |
|---|