EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30O2 |
| Net Charge | 0 |
| Average Mass | 278.436 |
| Monoisotopic Mass | 278.22458 |
| SMILES | CCCC/C=C\C=C\C=C/CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h5-10H,2-4,11-17H2,1H3,(H,19,20)/b6-5-,8-7+,10-9- |
| InChIKey | CUXYLFPMQMFGPL-BGDVVUGTSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (9Z,11E,13Z)-octadecatrienoic acid (CHEBI:8638) has role antineoplastic agent (CHEBI:35610) |
| (9Z,11E,13Z)-octadecatrienoic acid (CHEBI:8638) has role plant metabolite (CHEBI:76924) |
| (9Z,11E,13Z)-octadecatrienoic acid (CHEBI:8638) is a 9,11,13-octadecatrienoic acid (CHEBI:38382) |
| Incoming Relation(s) |
| (9Z,11E,13Z)-octadeca-9,11,13-trienoyl-containing glycerolipid (CHEBI:88259) has functional parent (9Z,11E,13Z)-octadecatrienoic acid (CHEBI:8638) |
| (9Z,11E,13Z)-octadeca-9,11,13-trienoyl group (CHEBI:86283) is substituent group from (9Z,11E,13Z)-octadecatrienoic acid (CHEBI:8638) |
| IUPAC Name |
|---|
| (9Z,11E,13Z)-octadeca-9,11,13-trienoic acid |
| Synonyms | Source |
|---|---|
| 9c,11t,13c-18:3 | ChEBI |
| 9c,11t,13c-linolenic acid | ChEBI |
| 9cis,11trans,13cis-octadecatrienoic acid | ChEBI |
| 9-cis,11-trans,13-cis-octadecatrienoic acid | ChEBI |
| C18:3 n-5 cis, 7 trans, 9 cis | ChEBI |
| cis-9,trans-11,cis-13-Octadecatrienoic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00001236 | KNApSAcK |
| C08364 | KEGG COMPOUND |
| HMDB0030963 | HMDB |
| LMFA01030146 | LIPID MAPS |
| Punicic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1726550 | Reaxys |
| CAS:544-72-9 | KEGG COMPOUND |
| CAS:544-72-9 | ChemIDplus |
| Citations |
|---|