EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30O2 |
| Net Charge | 0 |
| Average Mass | 290.447 |
| Monoisotopic Mass | 290.22458 |
| SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)[C@H](O)CC[C@@]34[H])[C@@]1(C)CCC(=O)C2 |
| InChI | InChI=1S/C19H30O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h12,14-17,21H,3-11H2,1-2H3/t12-,14+,15+,16+,17-,18+,19+/m1/s1 |
| InChIKey | NVKAWKQGWWIWPM-BNFYIPGJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (21255593) |
| Roles Classification |
|---|
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5β-dihydroepitestosterone (CHEBI:86377) has role human xenobiotic metabolite (CHEBI:76967) |
| 5β-dihydroepitestosterone (CHEBI:86377) is a 17α-hydroxy steroid (CHEBI:35342) |
| 5β-dihydroepitestosterone (CHEBI:86377) is a 3-oxo-5β-steroid (CHEBI:1624) |
| 5β-dihydroepitestosterone (CHEBI:86377) is a androstanoid (CHEBI:50402) |
| IUPAC Name |
|---|
| (5β,17α)-17-hydroxyandrostan-3-one |
| Synonym | Source |
|---|---|
| (5β)-17α-hydroxyandrostan-3-one | ChEBI |
| UniProt Name | Source |
|---|---|
| 5β-dihydroepitestosterone | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3120177 | Reaxys |
| Citations |
|---|