EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16N4.HCl |
| Net Charge | 0 |
| Average Mass | 288.782 |
| Monoisotopic Mass | 288.11417 |
| SMILES | Cc1cc2nc3ccc(N(C)C)cc3nc2cc1N.Cl |
| InChI | InChI=1S/C15H16N4.ClH/c1-9-6-13-15(8-11(9)16)18-14-7-10(19(2)3)4-5-12(14)17-13;/h4-8H,16H2,1-3H3;1H |
| InChIKey | PGSADBUBUOPOJS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | two-colour indicator A colour indicator that possesses a different colour on each side of the transition interval. acid-base indicator An acid or base which exhibits a colour change on neutralization by the basic or acidic titrant at or near the equivalence point of a titration. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neutral red (CHEBI:86370) has part neutral red(1+) (CHEBI:86373) |
| neutral red (CHEBI:86370) has role acid-base indicator (CHEBI:50407) |
| neutral red (CHEBI:86370) has role dye (CHEBI:37958) |
| neutral red (CHEBI:86370) has role two-colour indicator (CHEBI:50412) |
| neutral red (CHEBI:86370) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| N8,N8,3-trimethylphenazine-2,8-diamine hydrochloride |
| Synonyms | Source |
|---|---|
| 3-Amino-7-dimethylamino-2-methylphenazine hydrochloride | ChemIDplus |
| C.I. Basic Red 5 | ChemIDplus |
| C.I. Basic Red 5, monohydrochloride | ChemIDplus |
| Neutral Red chloride | ChemIDplus |
| Toluylene Red | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Neutral_red | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3918740 | Reaxys |
| CAS:553-24-2 | ChemIDplus |
| Citations |
|---|