EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O7 |
| Net Charge | 0 |
| Average Mass | 194.139 |
| Monoisotopic Mass | 194.04265 |
| SMILES | O=C(O)C(=O)[C@H](O)[C@@H](O)[C@@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[AO211h]/1/ |
| InChI | InChI=1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-4,7-10H,1H2,(H,12,13)/t2-,3-,4+/m0/s1 |
| InChIKey | VBUYCZFBVCCYFD-YVZJFKFKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1007/s11306-014-0642-1) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-dehydro-L-gluconic acid (CHEBI:86363) has role human metabolite (CHEBI:77746) |
| 2-dehydro-L-gluconic acid (CHEBI:86363) is a ketogluconic acid (CHEBI:24967) |
| 2-dehydro-L-gluconic acid (CHEBI:86363) is enantiomer of iduronic acid (CHEBI:24769) |
| Incoming Relation(s) |
| iduronic acid (CHEBI:24769) is enantiomer of 2-dehydro-L-gluconic acid (CHEBI:86363) |
| IUPAC Name |
|---|
| L-fructosonic acid |
| Synonym | Source |
|---|---|
| 2-keto-L-gluconic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CN1594266 | Patent |
| EP0088408 | Patent |
| EP1409116 | Patent |
| US5795761 | Patent |
| WO02102499 | Patent |
| Citations |
|---|