EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O9 |
| Net Charge | 0 |
| Average Mass | 416.382 |
| Monoisotopic Mass | 416.11073 |
| SMILES | O=c1c(-c2ccc(O)cc2)coc2c([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O)ccc12 |
| InChI | InChI=1S/C21H20O9/c22-7-14-17(26)18(27)19(28)21(30-14)15-13(24)6-5-11-16(25)12(8-29-20(11)15)9-1-3-10(23)4-2-9/h1-6,8,14,17-19,21-24,26-28H,7H2/t14-,17-,18+,19-,21+/m1/s1 |
| InChIKey | HKEAFJYKMMKDOR-VPRICQMDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | ferroptosis inhibitor Any substance that inhibits the process of ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). |
| Applications: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. anti-inflammatory agent Any compound that has anti-inflammatory effects. antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| puerarin (CHEBI:8633) has functional parent isoflavone (CHEBI:18220) |
| puerarin (CHEBI:8633) has role anti-inflammatory agent (CHEBI:67079) |
| puerarin (CHEBI:8633) has role antioxidant (CHEBI:22586) |
| puerarin (CHEBI:8633) has role antipyretic (CHEBI:35493) |
| puerarin (CHEBI:8633) has role autophagy inducer (CHEBI:138880) |
| puerarin (CHEBI:8633) has role cardioprotective agent (CHEBI:77307) |
| puerarin (CHEBI:8633) has role ferroptosis inhibitor (CHEBI:173084) |
| puerarin (CHEBI:8633) has role plant metabolite (CHEBI:76924) |
| puerarin (CHEBI:8633) is a C-glycosyl compound (CHEBI:20857) |
| puerarin (CHEBI:8633) is a hydroxyisoflavone (CHEBI:38755) |
| puerarin (CHEBI:8633) is conjugate acid of puerarin(1−) (CHEBI:229573) |
| Incoming Relation(s) |
| 3''-oxopuearin (CHEBI:229562) has functional parent puerarin (CHEBI:8633) |
| puerarin xyloside (CHEBI:80896) has functional parent puerarin (CHEBI:8633) |
| puerarin(1−) (CHEBI:229573) is conjugate base of puerarin (CHEBI:8633) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-1-[7-hydroxy-3-(4-hydroxyphenyl)-4-oxo-4H-chromen-8-yl]-D-glucitol |
| Synonyms | Source |
|---|---|
| (1S)-1,5-anhydro-1-[7-hydroxy-3-(4-hydroxyphenyl)-4-oxo-4H-1-benzopyran-8-yl]-D-glucitol | IUPAC |
| 8-β-D-glucopyranosyl-7-hydroxy-3-(4-hydroxyphenyl)-4H-1-benzopyran-4-one | ChEBI |
| daidzein 8-C-glucoside | ChEBI |
| kakonein | LIPID MAPS |
| NPI 031G | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00006094 | KNApSAcK |
| C10524 | KEGG COMPOUND |
| CPD-25752 | MetaCyc |
| DB12290 | DrugBank |
| FDB029976 | FooDB |
| HMDB0240265 | HMDB |
| LMPK12050005 | LIPID MAPS |
| Puerarin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:64198 | Reaxys |
| CAS:3681-99-0 | KEGG COMPOUND |
| CAS:3681-99-0 | ChemIDplus |
| Citations |
|---|