EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H29N3O4 |
| Net Charge | 0 |
| Average Mass | 423.513 |
| Monoisotopic Mass | 423.21581 |
| SMILES | CCN(CC)C[C@@H](O)CNc1ccc(NC[C@H]2CO2)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C24H29N3O4/c1-3-27(4-2)13-15(28)11-25-19-9-10-20(26-12-16-14-31-16)22-21(19)23(29)17-7-5-6-8-18(17)24(22)30/h5-10,15-16,25-26,28H,3-4,11-14H2,1-2H3/t15-,16-/m0/s1 |
| InChIKey | JYOOEVFJWLBLKF-HOTGVXAUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BDA-366 (CHEBI:86325) has functional parent 9,10-anthraquinone (CHEBI:40448) |
| BDA-366 (CHEBI:86325) has role antineoplastic agent (CHEBI:35610) |
| BDA-366 (CHEBI:86325) has role apoptosis inducer (CHEBI:68495) |
| BDA-366 (CHEBI:86325) is a anthraquinone (CHEBI:22580) |
| BDA-366 (CHEBI:86325) is a epoxide (CHEBI:32955) |
| BDA-366 (CHEBI:86325) is a secondary alcohol (CHEBI:35681) |
| BDA-366 (CHEBI:86325) is a secondary amino compound (CHEBI:50995) |
| BDA-366 (CHEBI:86325) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 1-{[(2S)-3-(diethylamino)-2-hydroxypropyl]amino}-4-({[(2S)-oxiran-2-yl]methyl}amino)anthracene-9,10-dione |
| Citations |
|---|