EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Cl2Cu.2H2O |
| Net Charge | 0 |
| Average Mass | 170.482 |
| Monoisotopic Mass | 168.88843 |
| SMILES | [Cl][Cu][Cl].[H]O[H].[H]O[H] |
| InChI | InChI=1S/2ClH.Cu.2H2O/h2*1H;;2*1H2/q;;+2;;/p-2 |
| InChIKey | MPTQRFCYZCXJFQ-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Biological Role: | EC 5.3.3.5 (cholestenol Delta-isomerase) inhibitor An EC 5.3.3.* (intramolecular oxidase transposing C=C bonds) inhibitor that interferes with the action of a cholestenol Δ-isomerase (EC 5.3.3.5). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| copper(II) chloride dihydrate (CHEBI:86318) has part copper(II) chloride (CHEBI:49553) |
| copper(II) chloride dihydrate (CHEBI:86318) has role EC 5.3.3.5 (cholestenol Δ-isomerase) inhibitor (CHEBI:86385) |
| copper(II) chloride dihydrate (CHEBI:86318) is a halide mineral (CHEBI:46714) |
| copper(II) chloride dihydrate (CHEBI:86318) is a hydrate (CHEBI:35505) |
| IUPAC Names |
|---|
| copper(2+) dichloride —water (1/2) |
| copper dichloride—water (1/2) |
| copper(II) chloride—water (1/2) |
| Synonyms | Source |
|---|---|
| copper(II) chloride·2H2O | ChEBI |
| CuCl2.2H2O | ChEBI |
| CuCl2·2H2O | ChEBI |
| cupric chloride·2H2O | ChEBI |
| cupric chloride dihydrate | ChEBI |
| Brand Names | Source |
|---|---|
| Coppertrace | ChemIDplus |
| eriochalcite | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11322055 | Reaxys |
| CAS:10125-13-0 | ChemIDplus |
| Citations |
|---|