EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16O3 |
| Net Charge | 0 |
| Average Mass | 256.301 |
| Monoisotopic Mass | 256.10994 |
| SMILES | COc1cc(/C=C/c2ccc(O)cc2)cc(OC)c1 |
| InChI | InChI=1S/C16H16O3/c1-18-15-9-13(10-16(11-15)19-2)4-3-12-5-7-14(17)8-6-12/h3-11,17H,1-2H3/b4-3+ |
| InChIKey | VLEUZFDZJKSGMX-ONEGZZNKSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pterocarpus marsupium (IPNI:516505-1) | heartwood (PO:0004512) | DOI (10.1021/np50031a029) | |
| Vaccinium (ncbitaxon:13749) | fruit (BTO:0000486) | PubMed (15264904) | |
| Vitis vinifera (ncbitaxon:29760) | |||
| leaf (BTO:0000713) | PubMed (11312782) | ||
| fruit (BTO:0000486) | PubMed (11312782) |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | neurotransmitter An endogenous compound that is used to transmit information across the synapse between a neuron and another cell. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. renoprotective agent Any compound that is able to prevent damage to the kidneys. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pterostilbene (CHEBI:8630) has parent hydride trans-stilbene (CHEBI:36007) |
| pterostilbene (CHEBI:8630) has role anti-inflammatory agent (CHEBI:67079) |
| pterostilbene (CHEBI:8630) has role antineoplastic agent (CHEBI:35610) |
| pterostilbene (CHEBI:8630) has role antioxidant (CHEBI:22586) |
| pterostilbene (CHEBI:8630) has role apoptosis inducer (CHEBI:68495) |
| pterostilbene (CHEBI:8630) has role hypoglycemic agent (CHEBI:35526) |
| pterostilbene (CHEBI:8630) has role neuroprotective agent (CHEBI:63726) |
| pterostilbene (CHEBI:8630) has role neurotransmitter (CHEBI:25512) |
| pterostilbene (CHEBI:8630) has role plant metabolite (CHEBI:76924) |
| pterostilbene (CHEBI:8630) has role radical scavenger (CHEBI:48578) |
| pterostilbene (CHEBI:8630) has role renoprotective agent (CHEBI:231911) |
| pterostilbene (CHEBI:8630) is a diether (CHEBI:46786) |
| pterostilbene (CHEBI:8630) is a methoxybenzenes (CHEBI:51683) |
| pterostilbene (CHEBI:8630) is a stilbenol (CHEBI:36027) |
| IUPAC Name |
|---|
| 4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenol |
| Synonyms | Source |
|---|---|
| 3,5-dimethoxy-4'-hydroxy-trans-stilbene | ChEBI |
| 3',5'-dimethoxy-4-stilbenol | ChemIDplus |
| 3',5'-dimethoxy-resveratrol | ChEBI |
| 4-(2-(3,5-Dimethoxyphenyl)ethenyl)phenol | ChemIDplus |
| 4-(3,5-dimethoxystyryl)phenol | ChEMBL |
| 4-[(E)-2-(3,5-dimethoxyphenyl)vinyl]phenol | IUPAC |
| Brand Name | Source |
|---|---|
| Pterostilbene component of eh-301 | ChEMBL |
| UniProt Name | Source |
|---|---|
| pterostilbene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 3RL | PDBeChem |
| 4445042 | ChemSpider |
| C00002902 | KNApSAcK |
| C10287 | KEGG COMPOUND |
| CN101912377 | Patent |
| CPD-6959 | MetaCyc |
| EP2445488 | Patent |
| FDB012375 | FooDB |
| HMDB0130987 | HMDB |
| KR20120000824 | Patent |
| LMPK13090015 | LIPID MAPS |
| LSM-43245 | LINCS |
| Pterostilbene | Wikipedia |
| US2011224290 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2054316 | Reaxys |
| CAS:537-42-8 | KEGG COMPOUND |
| CAS:537-42-8 | ChemIDplus |
| Citations |
|---|