EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H20N4O |
| Net Charge | 0 |
| Average Mass | 380.451 |
| Monoisotopic Mass | 380.16371 |
| SMILES | CC(C)Oc1ccc(-c2cnc3c(-c4ccnc5ccccc45)cnn3c2)cc1 |
| InChI | InChI=1S/C24H20N4O/c1-16(2)29-19-9-7-17(8-10-19)18-13-26-24-22(14-27-28(24)15-18)20-11-12-25-23-6-4-3-5-21(20)23/h3-16H,1-2H3 |
| InChIKey | JMIFGARJSWXZSH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | bone morphogenetic protein receptor antagonist An antagonist at the bone morphogenetic protein receptor. protein kinase inhibitor An EC 2.7.* (P-containing group transferase) inhibitor that interferes with the action of protein kinases. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DMH1 (CHEBI:86289) has role antineoplastic agent (CHEBI:35610) |
| DMH1 (CHEBI:86289) has role bone morphogenetic protein receptor antagonist (CHEBI:78623) |
| DMH1 (CHEBI:86289) has role protein kinase inhibitor (CHEBI:37699) |
| DMH1 (CHEBI:86289) is a aromatic ether (CHEBI:35618) |
| DMH1 (CHEBI:86289) is a pyrazolopyrimidine (CHEBI:38669) |
| DMH1 (CHEBI:86289) is a quinolines (CHEBI:26513) |
| IUPAC Name |
|---|
| 4-(6-{4-[(propan-2-yl)oxy]phenyl}pyrazolo[1,5-a]pyrimidin-3-yl)quinoline |
| Synonyms | Source |
|---|---|
| DMH-1 | ChEBI |
| DMH 1 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20934957 | Reaxys |
| Citations |
|---|