EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H31N7O15P2 |
| Net Charge | 0 |
| Average Mass | 671.450 |
| Monoisotopic Mass | 671.13534 |
| SMILES | CC(=O)N[C@H]1[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](n3cnc4c(=O)nc(N)nc43)[C@H](O)[C@@H]2O)O[C@H](C)[C@@H](NC(C)=O)[C@@H]1O |
| InChI | InChI=1S/C20H31N7O15P2/c1-6-10(23-7(2)28)14(31)11(24-8(3)29)19(39-6)41-44(36,37)42-43(34,35)38-4-9-13(30)15(32)18(40-9)27-5-22-12-16(27)25-20(21)26-17(12)33/h5-6,9-11,13-15,18-19,30-32H,4H2,1-3H3,(H,23,28)(H,24,29)(H,34,35)(H,36,37)(H3,21,25,26,33)/t6-,9-,10-,11-,13-,14+,15-,18-,19-/m1/s1 |
| InChIKey | UFDVBOLRIAJRHF-ZSSIDFSASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Campylobacter jejuni (ncbitaxon:197) | - | PubMed (19282391) |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GDP-N,N'-diacetylbacillosamine (CHEBI:86287) has functional parent bacillosamine (CHEBI:32538) |
| GDP-N,N'-diacetylbacillosamine (CHEBI:86287) has role bacterial metabolite (CHEBI:76969) |
| GDP-N,N'-diacetylbacillosamine (CHEBI:86287) is a GDP-hexose (CHEBI:21167) |
| GDP-N,N'-diacetylbacillosamine (CHEBI:86287) is conjugate acid of GDP-N,N'-diacetylbacillosamine(2−) (CHEBI:86016) |
| Incoming Relation(s) |
| GDP-N,N'-diacetylbacillosamine(2−) (CHEBI:86016) is conjugate base of GDP-N,N'-diacetylbacillosamine (CHEBI:86287) |
| IUPAC Name |
|---|
| guanosine 5'-{3-[2,4-diacetamido-2,4,6-trideoxy-α-D-glucopyranosyl] dihydrogen diphosphate} |
| Synonym | Source |
|---|---|
| GDP-2,4-diacetamido-2,4,6-trideoxy-α-D-glucopyranose | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-13164 | MetaCyc |
| Citations |
|---|