EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10N2O5 |
| Net Charge | 0 |
| Average Mass | 226.188 |
| Monoisotopic Mass | 226.05897 |
| SMILES | N[C@H](Cc1ccc(O)c([N+](=O)[O-])c1)C(=O)O |
| InChI | InChI=1S/C9H10N2O5/c10-6(9(13)14)3-5-1-2-8(12)7(4-5)11(15)16/h1-2,4,6,12H,3,10H2,(H,13,14)/t6-/m1/s1 |
| InChIKey | FBTSQILOGYXGMD-ZCFIWIBFSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-nitro-D-tyrosine (CHEBI:86270) is a D-tyrosine derivative (CHEBI:84124) |
| 3-nitro-D-tyrosine (CHEBI:86270) is a D-α-amino acid (CHEBI:16733) |
| 3-nitro-D-tyrosine (CHEBI:86270) is a 3-nitrotyrosine (CHEBI:86269) |
| 3-nitro-D-tyrosine (CHEBI:86270) is enantiomer of 3-nitro-L-tyrosine (CHEBI:44454) |
| Incoming Relation(s) |
| 3-nitro-L-tyrosine (CHEBI:44454) is enantiomer of 3-nitro-D-tyrosine (CHEBI:86270) |
| IUPAC Name |
|---|
| 3-nitro-D-tyrosine |
| Synonym | Source |
|---|---|
| (2R)-2-amino-3-(4-hydroxy-3-nitrophenyl)propanoic acid | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9130221 | Reaxys |