EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10N2O5 |
| Net Charge | 0 |
| Average Mass | 226.188 |
| Monoisotopic Mass | 226.05897 |
| SMILES | NC(Cc1ccc(O)cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C9H10N2O5/c10-7(9(13)14)3-5-1-2-6(12)4-8(5)11(15)16/h1-2,4,7,12H,3,10H2,(H,13,14) |
| InChIKey | RCZUDMZUWULMID-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-nitrotyrosine (CHEBI:86268) is a 3-nitrophenols (CHEBI:88313) |
| 2-nitrotyrosine (CHEBI:86268) is a nitrotyrosine (CHEBI:86267) |
| IUPAC Name |
|---|
| 2-nitrotyrosine |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2868089 | Reaxys |