EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H27N3O9S3 |
| Net Charge | 0 |
| Average Mass | 693.781 |
| Monoisotopic Mass | 693.09094 |
| SMILES | Cc1cc(C(=C2C=CC(=Nc3ccc(S(=O)(=O)O)cc3)C=C2)c2ccc(Nc3ccc(S(=O)(=O)O)cc3)cc2)cc(S(=O)(=O)O)c1N |
| InChI | InChI=1S/C32H27N3O9S3/c1-20-18-23(19-30(32(20)33)47(42,43)44)31(21-2-6-24(7-3-21)34-26-10-14-28(15-11-26)45(36,37)38)22-4-8-25(9-5-22)35-27-12-16-29(17-13-27)46(39,40)41/h2-19,34H,33H2,1H3,(H,36,37,38)(H,39,40,41)(H,42,43,44)/b31-22-,35-25? |
| InChIKey | WXESCRGMRLUOGU-LNLDCESDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NSC 56820 (CHEBI:86247) is a amino sulfonic acid (CHEBI:37793) |
| NSC 56820 (CHEBI:86247) is a ketimine (CHEBI:33272) |
| NSC 56820 (CHEBI:86247) is a organosulfonic acid (CHEBI:33551) |
| NSC 56820 (CHEBI:86247) is conjugate acid of NSC 56820(2−) (CHEBI:86250) |
| Incoming Relation(s) |
| NSC 56820(2−) (CHEBI:86250) is conjugate base of NSC 56820 (CHEBI:86247) |
| IUPAC Name |
|---|
| 2-amino-3-methyl-5-({4-[(4-sulfophenyl)amino]phenyl}{4-[(4-sulfophenyl)imino]cyclohexa-2,5-dien-1-ylidene}methyl)benzenesulfonic acid |
| Synonym | Source |
|---|---|
| water blue (acid form) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20756621 | Reaxys |