EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CO3.Fe |
| Net Charge | 0 |
| Average Mass | 115.853 |
| Monoisotopic Mass | 115.91968 |
| SMILES | O=C([O-])[O-].[Fe+2] |
| InChI | InChI=1S/CH2O3.Fe/c2-1(3)4;/h(H2,2,3,4);/q;+2/p-2 |
| InChIKey | RAQDACVRFCEPDA-UHFFFAOYSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ferrous carbonate (CHEBI:86235) has role anti-anaemic agent (CHEBI:75835) |
| ferrous carbonate (CHEBI:86235) is a carbonate mineral (CHEBI:46720) |
| ferrous carbonate (CHEBI:86235) is a carbonate salt (CHEBI:46721) |
| ferrous carbonate (CHEBI:86235) is a iron molecular entity (CHEBI:24873) |
| ferrous carbonate (CHEBI:86235) is a one-carbon compound (CHEBI:64708) |
| Synonyms | Source |
|---|---|
| Ferrous carbonate | ChEMBL |
| Ferrous monocarbonate | ChemIDplus |
| Ferrum carbonicum | ChEMBL |
| iron(2+) carbonate | ChEBI |
| Iron carbonate | ChemIDplus |
| Iron carbonate (feco3) | ChEMBL |
| Citations |
|---|