EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H8N2O8S2 |
| Net Charge | 0 |
| Average Mass | 396.358 |
| Monoisotopic Mass | 395.97221 |
| SMILES | O=C(O)c1cc(SSc2ccc([N+](=O)[O-])c(C(=O)O)c2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H8N2O8S2/c17-13(18)9-5-7(1-3-11(9)15(21)22)25-26-8-2-4-12(16(23)24)10(6-8)14(19)20/h1-6H,(H,17,18)(H,19,20) |
| InChIKey | KIUMMUBSPKGMOY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | indicator Anything used in a scientific experiment to indicate the presence of a substance or quality, change in a body, etc. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dithionitrobenzoic acid (CHEBI:86228) has role indicator (CHEBI:47867) |
| dithionitrobenzoic acid (CHEBI:86228) is a nitrobenzoic acid (CHEBI:25553) |
| dithionitrobenzoic acid (CHEBI:86228) is a organic disulfide (CHEBI:35489) |
| IUPAC Name |
|---|
| 3,3'-disulfanediylbis(6-nitrobenzoic acid) |
| Synonyms | Source |
|---|---|
| 3,3'-Dithiobis(6-nitrobenzoic acid) | ChemIDplus |
| 2,2'-Dinitro-5,5'-dithiodibenzoic acid | ChemIDplus |
| Dithiobisnitrobenzoic acid | ChemIDplus |
| 5,5'-dithiobis(2-nitrobenzoic acid) | ChEBI |
| DTNB | ChemIDplus |
| 2,2'-Dinitro-5,5'-dithiodibenzoesäure | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| DITHIO-NITROBENZOATE | MetaCyc |
| Ellman's_reagent | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1896821 | Reaxys |
| CAS:69-78-3 | ChemIDplus |
| Citations |
|---|