EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15NO |
| Net Charge | 0 |
| Average Mass | 177.247 |
| Monoisotopic Mass | 177.11536 |
| SMILES | [H]C(=O)c1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C11H15NO/c1-3-12(4-2)11-7-5-10(9-13)6-8-11/h5-9H,3-4H2,1-2H3 |
| InChIKey | MNFZZNNFORDXSV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 1.2.1.3 [aldehyde dehydrogenase (NAD(+))] inhibitor An EC 1.2.1.* (oxidoreductase acting on donor aldehyde/oxo group with NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of aldehyde dehydrogenase (NAD+), EC 1.2.1.3. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(diethylamino)benzaldehyde (CHEBI:86194) has role EC 1.2.1.3 [aldehyde dehydrogenase (NAD+)] inhibitor (CHEBI:35487) |
| 4-(diethylamino)benzaldehyde (CHEBI:86194) is a aromatic amine (CHEBI:33860) |
| 4-(diethylamino)benzaldehyde (CHEBI:86194) is a benzaldehydes (CHEBI:22698) |
| 4-(diethylamino)benzaldehyde (CHEBI:86194) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 4-(diethylamino)benzaldehyde |
| Synonyms | Source |
|---|---|
| 4-diethylaminobenzaldehyde | SUBMITTER |
| 4-(N,N-Diethylamino)benzaldehyde | NIST Chemistry WebBook |
| p-(Diethylamino)benzaldehyde | ChemIDplus |
| p-Formyl-N,N-diethylaniline | ChemIDplus |
| Citations |
|---|