EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26F2N2O4 |
| Net Charge | 0 |
| Average Mass | 432.467 |
| Monoisotopic Mass | 432.18606 |
| SMILES | C[C@H](NC(=O)Cc1cc(F)cc(F)c1)C(=O)N[C@H](C(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C23H26F2N2O4/c1-14(26-19(28)12-15-10-17(24)13-18(25)11-15)21(29)27-20(16-8-6-5-7-9-16)22(30)31-23(2,3)4/h5-11,13-14,20H,12H2,1-4H3,(H,26,28)(H,27,29)/t14-,20-/m0/s1 |
| InChIKey | DWJXYEABWRJFSP-XOBRGWDASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 3.4.23.46 (memapsin 2) inhibitor An EC 3.4.23.* (aspartic endopeptidase) inhibitor that interferes with the activity of memapsin 2 (EC 3.4.23.46). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DAPT (CHEBI:86193) has role EC 3.4.23.46 (memapsin 2) inhibitor (CHEBI:74925) |
| DAPT (CHEBI:86193) is a tert-butyl ester (CHEBI:140402) |
| DAPT (CHEBI:86193) is a carboxylic ester (CHEBI:33308) |
| DAPT (CHEBI:86193) is a difluorobenzene (CHEBI:38582) |
| DAPT (CHEBI:86193) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| tert-butyl (2S)-({N-[(3,5-difluorophenyl)acetyl]-L-alanyl}amino)(phenyl)acetate |
| Synonyms | Source |
|---|---|
| tert-butyl (2S)-2-[[(2S)-2-[[2-(3,5-difluorophenyl)acetyl]amino]propanoyl]amino]-2-phenylacetate | SUBMITTER |
| GSI-IX | ChEBI |
| γ-secretase inhibitor IX | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9588440 | Reaxys |
| Citations |
|---|