EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:86192 - butyl anthranilate
| Formula | C11H15NO2 |
| Net Charge | 0 |
| Average Mass | 193.246 |
| Monoisotopic Mass | 193.11028 |
| SMILES | CCCCOC(=O)c1ccccc1N |
| InChI | InChI=1S/C11H15NO2/c1-2-3-8-14-11(13)9-6-4-5-7-10(9)12/h4-7H,2-3,8,12H2,1H3 |
| InChIKey | HUIYGGQINIVDNW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Applications: | fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. insect repellent An insecticide that acts as a repellent to insects. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butyl anthranilate (CHEBI:86192) has functional parent anthranilic acid (CHEBI:30754) |
| butyl anthranilate (CHEBI:86192) has functional parent butan-1-ol (CHEBI:28885) |
| butyl anthranilate (CHEBI:86192) has role flavouring agent (CHEBI:35617) |
| butyl anthranilate (CHEBI:86192) has role fragrance (CHEBI:48318) |
| butyl anthranilate (CHEBI:86192) has role insect repellent (CHEBI:71692) |
| butyl anthranilate (CHEBI:86192) has role plant metabolite (CHEBI:76924) |
| butyl anthranilate (CHEBI:86192) is a benzoate ester (CHEBI:36054) |
| butyl anthranilate (CHEBI:86192) is a substituted aniline (CHEBI:48975) |
| Synonyms | Source |
|---|---|
| Butyl 2-aminobenzoate | ChemIDplus |
| 2-Aminobenzoic acid butyl ester | ChemIDplus |
| n-Butyl o-aminobenzoate | ChemIDplus |
| Butyl o-aminobenzoate | ChemIDplus |
| n-Butyl anthranilate | ChemIDplus |
| Anthranilic acid, butyl ester | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0036906 | HMDB |
| US5437991 | Patent |
| Citations |
|---|