EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16O6 |
| Net Charge | 0 |
| Average Mass | 340.331 |
| Monoisotopic Mass | 340.09469 |
| SMILES | [H][C@]1([C@@]2(C)CO2)Cc2c(cc(OC)c3c(=O)c4cccc(O)c4oc23)O1 |
| InChI | InChI=1S/C19H16O6/c1-19(8-23-19)14-6-10-12(24-14)7-13(22-2)15-16(21)9-4-3-5-11(20)17(9)25-18(10)15/h3-5,7,14,20H,6,8H2,1-2H3/t14-,19-/m1/s1 |
| InChIKey | BBNDPXOGORGETN-AUUYWEPGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Psorospermum febrifugum (ncbitaxon:999591) | - | PubMed (7189773) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| psorospermin (CHEBI:8617) has role antineoplastic agent (CHEBI:35610) |
| psorospermin (CHEBI:8617) has role plant metabolite (CHEBI:76924) |
| psorospermin (CHEBI:8617) is a epoxide (CHEBI:32955) |
| psorospermin (CHEBI:8617) is a organic heterotetracyclic compound (CHEBI:38163) |
| psorospermin (CHEBI:8617) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| (2R)-10-hydroxy-5-methoxy-2-[(2R)-2-methyloxiran-2-yl]-1,2-dihydro-6H-furo[2,3-c]xanthen-6-one |
| Manual Xrefs | Databases |
|---|---|
| C00002972 | KNApSAcK |
| C10090 | KEGG COMPOUND |
| EP1585740 | Patent |
| US2004102515 | Patent |
| US6933396 | Patent |
| WO2004019888 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5140143 | Reaxys |
| CAS:74045-97-9 | KEGG COMPOUND |
| Citations |
|---|