EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H28Br2O5S |
| Net Charge | 0 |
| Average Mass | 624.391 |
| Monoisotopic Mass | 622.00242 |
| SMILES | Cc1c(C2(c3cc(C(C)C)c(O)c(Br)c3C)OS(=O)(=O)c3ccccc32)cc(C(C)C)c(O)c1Br |
| InChI | InChI=1S/C27H28Br2O5S/c1-13(2)17-11-20(15(5)23(28)25(17)30)27(19-9-7-8-10-22(19)35(32,33)34-27)21-12-18(14(3)4)26(31)24(29)16(21)6/h7-14,30-31H,1-6H3 |
| InChIKey | NUHCTOLBWMJMLX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | acid-base indicator An acid or base which exhibits a colour change on neutralization by the basic or acidic titrant at or near the equivalence point of a titration. two-colour indicator A colour indicator that possesses a different colour on each side of the transition interval. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bromothymol blue (CHEBI:86155) has role acid-base indicator (CHEBI:50407) |
| bromothymol blue (CHEBI:86155) has role dye (CHEBI:37958) |
| bromothymol blue (CHEBI:86155) has role two-colour indicator (CHEBI:50412) |
| bromothymol blue (CHEBI:86155) is a 2,1-benzoxathiole (CHEBI:38087) |
| bromothymol blue (CHEBI:86155) is a arenesulfonate ester (CHEBI:38094) |
| bromothymol blue (CHEBI:86155) is a organobromine compound (CHEBI:37141) |
| bromothymol blue (CHEBI:86155) is a polyphenol (CHEBI:26195) |
| bromothymol blue (CHEBI:86155) is a sultone (CHEBI:38088) |
| IUPAC Name |
|---|
| 3,3-bis[3-bromo-4-hydroxy-2-methyl-5-(propan-2-yl)phenyl]-2,1λ6-benzoxathiole-1,1(3H)-dione |
| Synonyms | Source |
|---|---|
| 4,4'-(3H-2,1-Benzoxathiol-3-ylidene)bis(2-bromo-3-methyl-6-(1-methylethyl)phenol) S,S-dioxide | ChemIDplus |
| bromothymol sulfone phthalein | ChEBI |
| Bromthymol blue | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Bromothymol_blue | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:373934 | Reaxys |
| CAS:76-59-5 | ChemIDplus |
| Citations |
|---|