EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30O2 |
| Net Charge | 0 |
| Average Mass | 278.436 |
| Monoisotopic Mass | 278.22458 |
| SMILES | CCCCC/C=C\C=C\C=C\CCCCCCC(=O)O |
| InChI | InChI=1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-11H,2-5,12-17H2,1H3,(H,19,20)/b7-6-,9-8+,11-10+ |
| InChIKey | DQGMPXYVZZCNDQ-KBPWROHVSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Calendula officinalis (ncbitaxon:41496) | - | PubMed (23327299) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (8E,10E,12Z)-octadecatrienoic acid (CHEBI:86148) has role plant metabolite (CHEBI:76924) |
| (8E,10E,12Z)-octadecatrienoic acid (CHEBI:86148) is a conjugated linolenic acid (CHEBI:61160) |
| (8E,10E,12Z)-octadecatrienoic acid (CHEBI:86148) is a ω−6 fatty acid (CHEBI:36009) |
| Incoming Relation(s) |
| (8E,10E,12Z)-octadecatrienoyl-containing glycerolipid (CHEBI:88257) has functional parent (8E,10E,12Z)-octadecatrienoic acid (CHEBI:86148) |
| (8E,10E,12Z)-octadecatrienoyl group (CHEBI:86118) is substituent group from (8E,10E,12Z)-octadecatrienoic acid (CHEBI:86148) |
| IUPAC Name |
|---|
| (8E,10E,12Z)-octadeca-8,10,12-trienoic acid |
| Synonyms | Source |
|---|---|
| 8E,10E,12Z-octadecatrienoic acid | LIPID MAPS |
| C18:3n-6,8,10 | LIPID MAPS |
| Calendic acid | ChemIDplus |
| Calendulic acid | HMDB |
| trans-8, trans-10, cis-12-octadecatrienoic acid | LIPID MAPS |
| α-calendic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| Calendic_acid | Wikipedia |
| CPD-8228 | MetaCyc |
| HMDB0030962 | HMDB |
| LMFA01030144 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1726537 | Reaxys |
| CAS:5204-87-5 | ChemIDplus |
| Citations |
|---|