EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30O2 |
| Net Charge | 0 |
| Average Mass | 278.436 |
| Monoisotopic Mass | 278.22458 |
| SMILES | CCCCC/C=C\C/C=C\CC/C=C\CCCC(=O)O |
| InChI | InChI=1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-7,9-10,13-14H,2-5,8,11-12,15-17H2,1H3,(H,19,20)/b7-6-,10-9-,14-13- |
| InChIKey | HXQHFNIKBKZGRP-URPRIDOGSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pinus koraiensis (ncbitaxon:88728) | - | PubMed (21953622) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5Z,9Z,12Z)-octadecatrienoic acid (CHEBI:86136) has role antineoplastic agent (CHEBI:35610) |
| (5Z,9Z,12Z)-octadecatrienoic acid (CHEBI:86136) has role plant metabolite (CHEBI:76924) |
| (5Z,9Z,12Z)-octadecatrienoic acid (CHEBI:86136) is a octadecatrienoic acid (CHEBI:25633) |
| Incoming Relation(s) |
| (5Z,9Z,12Z)-octadecatrienoyl-containing glycerolipid (CHEBI:88238) has functional parent (5Z,9Z,12Z)-octadecatrienoic acid (CHEBI:86136) |
| (5Z,9Z,12Z)-octadecatrienoyl group (CHEBI:85916) is substituent group from (5Z,9Z,12Z)-octadecatrienoic acid (CHEBI:86136) |
| IUPAC Name |
|---|
| (5Z,9Z,12Z)-octadeca-5,9,12-trienoic acid |
| Synonyms | Source |
|---|---|
| 5Z,9Z,12Z-octadecatrienoic acid | LIPID MAPS |
| C18:3n-6,9,13 | LIPID MAPS |
| cis,cis,cis-5,9,12-Octadecatrienoic acid | ChemIDplus |
| all-cis-octadeca-5,9,12-trienoic acid | ChEBI |
| Pinolenic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| CPD-14869 | MetaCyc |
| LMFA01030344 | LIPID MAPS |
| Pinolenic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1912698 | Reaxys |
| CAS:16833-54-8 | ChemIDplus |
| Citations |
|---|