EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:86135 - (5Z,9Z,12Z,15Z)-octadecatetraenoic acid
| Formula | C18H28O2 |
| Net Charge | 0 |
| Average Mass | 276.420 |
| Monoisotopic Mass | 276.20893 |
| SMILES | CC/C=C\C/C=C\C/C=C\CC/C=C\CCCC(=O)O |
| InChI | InChI=1S/C18H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10,13-14H,2,5,8,11-12,15-17H2,1H3,(H,19,20)/b4-3-,7-6-,10-9-,14-13- |
| InChIKey | DNOBNGNBPVOMLW-XRPCLMINSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | Article (16267098) | |
| Chamaecyparis hodginsii (ncbitaxon:89191) | seed (BTO:0001226) | Article (AGR:IND21991083) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5Z,9Z,12Z,15Z)-octadecatetraenoic acid (CHEBI:86135) has role algal metabolite (CHEBI:84735) |
| (5Z,9Z,12Z,15Z)-octadecatetraenoic acid (CHEBI:86135) has role plant metabolite (CHEBI:76924) |
| (5Z,9Z,12Z,15Z)-octadecatetraenoic acid (CHEBI:86135) is a octadecatetraenoic acid (CHEBI:37810) |
| Incoming Relation(s) |
| (5Z,9Z,12Z,15Z)-octadecatetraenoyl-containing glycerolipid (CHEBI:88239) has functional parent (5Z,9Z,12Z,15Z)-octadecatetraenoic acid (CHEBI:86135) |
| (5Z,9Z,12Z,15Z)-octadecatetraenoyl group (CHEBI:85915) is substituent group from (5Z,9Z,12Z,15Z)-octadecatetraenoic acid (CHEBI:86135) |
| IUPAC Name |
|---|
| (5Z,9Z,12Z,15Z)-octadeca-5,9,12,15-tetraenoic acid |
| Synonyms | Source |
|---|---|
| all-cis-octadeca-5,9,12,15-tetraenoic acid | ChEBI |
| 18:4(5Z,9Z,12Z,15Z) | LIPID MAPS |
| 5,9,12,15-octadecatetraenoic acid | LIPID MAPS |
| C18:4n-3,6,9,13 | LIPID MAPS |
| coniferonic acid | MetaCyc |
| (5,9,12,15)-coniferonic acid | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030355 | LIPID MAPS |
| CPD-14868 | MetaCyc |
| Citations |
|---|