EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14N2O2 |
| Net Charge | 0 |
| Average Mass | 218.256 |
| Monoisotopic Mass | 218.10553 |
| SMILES | Cc1nc2ccccc2c1C[C@H](N)C(=O)O |
| InChI | InChI=1S/C12H14N2O2/c1-7-9(6-10(13)12(15)16)8-4-2-3-5-11(8)14-7/h2-5,10,14H,6,13H2,1H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | BXJSOEWOQDVGJW-JTQLQIEISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces laurentii (ncbitaxon:39478) | - | PubMed (2321967) |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methyl-L-tryptophan (CHEBI:86128) has role bacterial metabolite (CHEBI:76969) |
| 2-methyl-L-tryptophan (CHEBI:86128) is a L-tryptophan derivative (CHEBI:47994) |
| 2-methyl-L-tryptophan (CHEBI:86128) is tautomer of 2-methyl-L-tryptophan zwitterion (CHEBI:85908) |
| Incoming Relation(s) |
| 2-methyl-L-tryptophan zwitterion (CHEBI:85908) is tautomer of 2-methyl-L-tryptophan (CHEBI:86128) |
| IUPAC Name |
|---|
| 2-methyl-L-tryptophan |
| Synonyms | Source |
|---|---|
| 2-Methyltryptophan | ChemIDplus |
| L-2-Methyltryptophan | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10551509 | Reaxys |
| CAS:33468-32-5 | KEGG COMPOUND |
| CAS:33468-32-5 | ChemIDplus |
| Citations |
|---|