EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O3 |
| Net Charge | 0 |
| Average Mass | 416.646 |
| Monoisotopic Mass | 416.32905 |
| SMILES | [H]C(=O)[C@H](C)CCC[C@@H](C)[C@@]1([H])CC[C@@]2([H])[C@]3([H])CC=C4[C@@H](O)[C@@H](O)CC[C@]4(C)[C@@]3([H])CC[C@@]21C |
| InChI | InChI=1S/C27H44O3/c1-17(16-28)6-5-7-18(2)20-10-11-21-19-8-9-23-25(30)24(29)13-15-27(23,4)22(19)12-14-26(20,21)3/h9,16-22,24-25,29-30H,5-8,10-15H2,1-4H3/t17-,18-,19+,20-,21+,22+,24+,25-,26-,27-/m1/s1 |
| InChIKey | MHAIQEGJDLCDNU-KUYJPBLDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (12077124) |
| Roles Classification |
|---|
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (25R)-3β,4β-dihydroxycholest-5-en-26-al (CHEBI:86115) has role human xenobiotic metabolite (CHEBI:76967) |
| (25R)-3β,4β-dihydroxycholest-5-en-26-al (CHEBI:86115) is a 26-oxo steroid (CHEBI:36884) |
| (25R)-3β,4β-dihydroxycholest-5-en-26-al (CHEBI:86115) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| (25R)-3β,4β-dihydroxycholest-5-en-26-al (CHEBI:86115) is a 3β-sterol (CHEBI:35348) |
| (25R)-3β,4β-dihydroxycholest-5-en-26-al (CHEBI:86115) is a 4-hydroxy steroid (CHEBI:62846) |
| (25R)-3β,4β-dihydroxycholest-5-en-26-al (CHEBI:86115) is a cholestanoid (CHEBI:50401) |
| (25R)-3β,4β-dihydroxycholest-5-en-26-al (CHEBI:86115) is a oxysterol (CHEBI:53030) |
| (25R)-3β,4β-dihydroxycholest-5-en-26-al (CHEBI:86115) is a steroid aldehyde (CHEBI:131565) |
| IUPAC Name |
|---|
| (3β,4β,25R)-3,4-dihydroxycholest-5-en-26-al |
| UniProt Name | Source |
|---|---|
| (25R)-3β,4β-dihydroxycholest-5-en-26-al | UniProt |
| Citations |
|---|