EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H46O3 |
| Net Charge | 0 |
| Average Mass | 418.662 |
| Monoisotopic Mass | 418.34470 |
| SMILES | [H][C@@]12CC=C3[C@@H](O)[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)CC[C@H](O)C(C)C |
| InChI | InChI=1S/C27H46O3/c1-16(2)23(28)11-6-17(3)19-9-10-20-18-7-8-22-25(30)24(29)13-15-27(22,5)21(18)12-14-26(19,20)4/h8,16-21,23-25,28-30H,6-7,9-15H2,1-5H3/t17-,18+,19-,20+,21+,23+,24+,25-,26-,27-/m1/s1 |
| InChIKey | IWXJGKGAPXGSCN-GCUSXLOISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (12077124) |
| Roles Classification |
|---|
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4β,24S-dihydroxycholesterol (CHEBI:86087) has role human xenobiotic metabolite (CHEBI:76967) |
| 4β,24S-dihydroxycholesterol (CHEBI:86087) is a 24-hydroxy steroid (CHEBI:36865) |
| 4β,24S-dihydroxycholesterol (CHEBI:86087) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| 4β,24S-dihydroxycholesterol (CHEBI:86087) is a 3β-sterol (CHEBI:35348) |
| 4β,24S-dihydroxycholesterol (CHEBI:86087) is a 4-hydroxy steroid (CHEBI:62846) |
| 4β,24S-dihydroxycholesterol (CHEBI:86087) is a cholestanoid (CHEBI:50401) |
| 4β,24S-dihydroxycholesterol (CHEBI:86087) is a oxysterol (CHEBI:53030) |
| IUPAC Name |
|---|
| cholest-5-ene-3β,4β,24S-triol |
| Synonym | Source |
|---|---|
| (3β,4β,24S)-cholest-5-ene-3,4,24-triol | IUPAC |
| UniProt Name | Source |
|---|---|
| 4β,24S-dihydroxycholesterol | UniProt |
| Citations |
|---|