EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H25NO6 |
| Net Charge | 0 |
| Average Mass | 303.355 |
| Monoisotopic Mass | 303.16819 |
| SMILES | C[N+](C)(C)CC(CC(=O)[O-])OC(=O)CCCCCC(=O)O |
| InChI | InChI=1S/C14H25NO6/c1-15(2,3)10-11(9-13(18)19)21-14(20)8-6-4-5-7-12(16)17/h11H,4-10H2,1-3H3,(H-,16,17,18,19) |
| InChIKey | NTBUXPPQHCFLOM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-pimelylcarnitine (CHEBI:86084) has functional parent pimelic acid (CHEBI:30531) |
| O-pimelylcarnitine (CHEBI:86084) has role metabolite (CHEBI:25212) |
| O-pimelylcarnitine (CHEBI:86084) is a O-acylcarnitine (CHEBI:17387) |
| Incoming Relation(s) |
| O-pimelyl-L-carnitine (CHEBI:85525) is a O-pimelylcarnitine (CHEBI:86084) |
| IUPAC Name |
|---|
| 3-[(6-carboxyhexanoyl)oxy]-4-(trimethylazaniumyl)butanoate |
| Synonym | Source |
|---|---|
| pimelylcarnitine | ChEBI |