EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H23NO4 |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 257.326 |
| Monoisotopic Mass (excl. R groups) | 257.16271 |
| SMILES | *C(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-hexenoylcarnitine (CHEBI:86082) has functional parent hexenoic acid (CHEBI:24580) |
| O-hexenoylcarnitine (CHEBI:86082) has role metabolite (CHEBI:25212) |
| O-hexenoylcarnitine (CHEBI:86082) is a O-acylcarnitine (CHEBI:17387) |
| Incoming Relation(s) |
| O-hexenoyl-L-carnitine (CHEBI:85523) is a O-hexenoylcarnitine (CHEBI:86082) |
| Synonyms | Source |
|---|---|
| O-hexenoylcarnitines | ChEBI |
| hexenoylcarnitine | ChEBI |
| hexenoylcarnitines | ChEBI |