EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20N4O2 |
| Net Charge | 0 |
| Average Mass | 276.340 |
| Monoisotopic Mass | 276.15863 |
| SMILES | N=C(N)NCCCCNC(=O)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C14H20N4O2/c15-14(16)18-10-2-1-9-17-13(20)8-5-11-3-6-12(19)7-4-11/h3-8,19H,1-2,9-10H2,(H,17,20)(H4,15,16,18)/b8-5+ |
| InChIKey | AKIHYQWCLCDMMI-VMPITWQZSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-p-coumaroylagmatine (CHEBI:86080) has functional parent trans-4-coumaric acid (CHEBI:32374) |
| (E)-p-coumaroylagmatine (CHEBI:86080) is a p-coumaroylagmatine (CHEBI:32818) |
| (E)-p-coumaroylagmatine (CHEBI:86080) is conjugate base of (E)-p-coumaroylagmatine(1+) (CHEBI:86078) |
| Incoming Relation(s) |
| (E)-p-coumaroylagmatine(1+) (CHEBI:86078) is conjugate acid of (E)-p-coumaroylagmatine (CHEBI:86080) |
| IUPAC Name |
|---|
| (2E)-N-[4-(carbamimidamido)butyl]-3-(4-hydroxyphenyl)prop-2-enamide |
| Synonyms | Source |
|---|---|
| 1-(trans-4'-hydroxycinnamoylamino)-4-guanidinobutane | ChEBI |
| (E)-coumaroylagmatine | ChEBI |
| (E)-N-(4-guanidinobutyl)-4-hydroxycinnamamide | ChEBI |
| trans-coumaroylagmatine | ChEBI |
| trans-p-coumaroylagmatine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6893419 | Reaxys |