EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H19NO4 |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 229.274 |
| Monoisotopic Mass (excl. R groups) | 229.13141 |
| SMILES | *C(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-butenoylcarnitine (CHEBI:86077) has functional parent butenoic acid (CHEBI:22959) |
| O-butenoylcarnitine (CHEBI:86077) has role metabolite (CHEBI:25212) |
| O-butenoylcarnitine (CHEBI:86077) is a O-acylcarnitine (CHEBI:17387) |
| Incoming Relation(s) |
| O-butenoyl-L-carnitine (CHEBI:85480) is a O-butenoylcarnitine (CHEBI:86077) |
| Synonym | Source |
|---|---|
| O-butenoylcarnitines | ChEBI |