EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H17NO4 |
| Net Charge | 0 |
| Average Mass | 215.249 |
| Monoisotopic Mass | 215.11576 |
| SMILES | C=CC(=O)O[C@@H](CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C10H17NO4/c1-5-10(14)15-8(6-9(12)13)7-11(2,3)4/h5,8H,1,6-7H2,2-4H3/t8-/m0/s1 |
| InChIKey | YUCNWOKTRWJLGY-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-propenoyl-D-carnitine (CHEBI:86076) is a O-acyl-L-carnitine (CHEBI:75659) |
| O-propenoyl-D-carnitine (CHEBI:86076) is a O-propenoylcarnitine (CHEBI:86073) |
| IUPAC Name |
|---|
| (3S)-3-(acryloyloxy)-4-(trimethylazaniumyl)butanoate |
| Synonym | Source |
|---|---|
| (3S)-3-(prop-2-enoyloxy)-4-(trimethylazaniumyl)butanoate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013124 | HMDB |