EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H39NO5 |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 385.538 |
| Monoisotopic Mass (excl. R groups) | 385.28282 |
| SMILES | *C(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | MetaboLights (MTBLS192) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-(hydroxytetradecenoyl)carnitine (CHEBI:86067) has role metabolite (CHEBI:25212) |
| O-(hydroxytetradecenoyl)carnitine (CHEBI:86067) is a O-acylcarnitine (CHEBI:17387) |
| Incoming Relation(s) |
| O-[(9Z)-3-hydroxytetradec-9-enoyl]carnitine (CHEBI:73062) is a O-(hydroxytetradecenoyl)carnitine (CHEBI:86067) |
| Synonyms | Source |
|---|---|
| O-(hydroxytetradecenoyl)carnitines | ChEBI |
| hydroxytetradecenoylcarnitine | ChEBI |
| hydroxytetradecenoylcarnitines | ChEBI |