EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30 |
| Net Charge | 0 |
| Average Mass | 270.460 |
| Monoisotopic Mass | 270.23475 |
| SMILES | [H][C@@]12CCc3cc(C(C)C)ccc3[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C20H30/c1-14(2)15-7-9-17-16(13-15)8-10-18-19(3,4)11-6-12-20(17,18)5/h7,9,13-14,18H,6,8,10-12H2,1-5H3/t18-,20+/m0/s1 |
| InChIKey | QUUCYKKMFLJLFS-AZUAARDMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rosmarinus officinalis (ncbitaxon:39367) | - | PubMed (26020634) | |
| Salvia miltiorrhiza (ncbitaxon:226208) | - | PubMed (24108414) | |
| Plectranthus barbatus (ncbitaxon:41228) | - | PubMed (24823881) | |
| Pogostemon hirsutus Benth (ncbitaxon:694404) | leaf (BTO:0000713) | PubMed (24555296) | |
| Calceolaria integrifolia (ncbitaxon:240950) | aerial part (BTO:0001658) | PubMed (23607420) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| abietatriene (CHEBI:86062) has parent hydride abietane (CHEBI:35673) |
| abietatriene (CHEBI:86062) has role plant metabolite (CHEBI:76924) |
| abietatriene (CHEBI:86062) is a diterpene (CHEBI:35190) |
| IUPAC Name |
|---|
| abieta-8,11,13-triene |
| Synonym | Source |
|---|---|
| Dehydroabietane | KNApSAcK |
| UniProt Name | Source |
|---|---|
| abieta-8,11,13-triene | UniProt |
| Citations |
|---|