EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13N5O3 |
| Net Charge | 0 |
| Average Mass | 251.246 |
| Monoisotopic Mass | 251.10184 |
| SMILES | [H][C@]1(CO)O[C@@]([H])(n2cnc3c(N)ncnc32)[C@@H]1CO |
| InChI | InChI=1S/C10H13N5O3/c11-8-7-9(13-3-12-8)15(4-14-7)10-5(1-16)6(2-17)18-10/h3-6,10,16-17H,1-2H2,(H2,11,12,13)/t5-,6-,10-/m1/s1 |
| InChIKey | LMJVXGOFWKVXAW-OXOINMOOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus megaterium (ncbitaxon:1404) | - | PubMed (3025147) | Strain: NK84-0218 |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxetanocin A (CHEBI:86012) has functional parent adenine (CHEBI:16708) |
| oxetanocin A (CHEBI:86012) has role anti-HIV agent (CHEBI:64946) |
| oxetanocin A (CHEBI:86012) has role antibacterial agent (CHEBI:33282) |
| oxetanocin A (CHEBI:86012) has role bacterial metabolite (CHEBI:76969) |
| oxetanocin A (CHEBI:86012) is a diol (CHEBI:23824) |
| oxetanocin A (CHEBI:86012) is a nucleoside analogue (CHEBI:60783) |
| oxetanocin A (CHEBI:86012) is a oxetanes (CHEBI:38784) |
| oxetanocin A (CHEBI:86012) is a primary alcohol (CHEBI:15734) |
| Incoming Relation(s) |
| oxetanocin A 4-(dihydrogen phosphate) (CHEBI:86011) has functional parent oxetanocin A (CHEBI:86012) |
| IUPAC Name |
|---|
| [(2S,3R,4R)-4-(6-amino-9H-purin-9-yl)oxetane-2,3-diyl]dimethanol |
| Synonyms | Source |
|---|---|
| 9-[(2R,3R,4S)-3,4-bis(hydroxymethyl)-2-oxetanyl]adenine | ChemIDplus |
| 9-((2'R,3'R,4'S)-3',4'-bis(hydroxymethyl)-2'-oxetanyl)adenine | ChEBI |
| NK 84-0218 | ChemIDplus |
| (−)-oxetanocin | ChEBI |
| oxetanocin | ChemIDplus |
| (−)-oxetanocin A | ChEBI |
| UniProt Name | Source |
|---|---|
| oxetanocin A | UniProt |
| Manual Xrefs | Databases |
|---|---|
| EP0290817 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4297990 | Reaxys |
| CAS:103913-16-2 | ChemIDplus |
| Citations |
|---|