EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15N5O5 |
| Net Charge | 0 |
| Average Mass | 309.282 |
| Monoisotopic Mass | 309.10732 |
| SMILES | NC(=O)c1cn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c2ncnc(N)c12 |
| InChI | InChI=1S/C12H15N5O5/c13-9-6-4(10(14)21)1-17(11(6)16-3-15-9)12-8(20)7(19)5(2-18)22-12/h1,3,5,7-8,12,18-20H,2H2,(H2,14,21)(H2,13,15,16)/t5-,7-,8-,12-/m1/s1 |
| InChIKey | OBZJZDHRXBKKTJ-JTFADIMSSA-N |
| Roles Classification |
|---|
| Biological Role: | protein kinase inhibitor An EC 2.7.* (P-containing group transferase) inhibitor that interferes with the action of protein kinases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sangivamycin (CHEBI:85997) has functional parent adenosine (CHEBI:16335) |
| sangivamycin (CHEBI:85997) has role protein kinase inhibitor (CHEBI:37699) |
| sangivamycin (CHEBI:85997) is a nucleoside analogue (CHEBI:60783) |
| IUPAC Name |
|---|
| 4-amino-7-β-D-ribofuranosyl-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide |
| Synonyms | Source |
|---|---|
| 7-Deaza-7-carbamoyladenosine | ChEBI |
| 7-Deazaadenosine-7-carboxamide | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:626355 | Reaxys |
| CAS:18417-89-5 | ChemIDplus |
| Citations |
|---|