EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H29N7O2 |
| Net Charge | 0 |
| Average Mass | 447.543 |
| Monoisotopic Mass | 447.23827 |
| SMILES | CC(=O)c1c(C)c2cnc(Nc3ccc(N4CCNCC4)cn3)nc2n(C2CCCC2)c1=O |
| InChI | InChI=1S/C24H29N7O2/c1-15-19-14-27-24(28-20-8-7-18(13-26-20)30-11-9-25-10-12-30)29-22(19)31(17-5-3-4-6-17)23(33)21(15)16(2)32/h7-8,13-14,17,25H,3-6,9-12H2,1-2H3,(H,26,27,28,29) |
| InChIKey | AHJRHEGDXFFMBM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.11.22 (cyclin-dependent kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of cyclin-dependent kinase (EC 2.7.11.22). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| palbociclib (CHEBI:85993) has role antineoplastic agent (CHEBI:35610) |
| palbociclib (CHEBI:85993) has role EC 2.7.11.22 (cyclin-dependent kinase) inhibitor (CHEBI:82665) |
| palbociclib (CHEBI:85993) is a aminopyridine (CHEBI:38207) |
| palbociclib (CHEBI:85993) is a aromatic ketone (CHEBI:76224) |
| palbociclib (CHEBI:85993) is a cyclopentanes (CHEBI:23493) |
| palbociclib (CHEBI:85993) is a piperidines (CHEBI:26151) |
| palbociclib (CHEBI:85993) is a pyridopyrimidine (CHEBI:38932) |
| palbociclib (CHEBI:85993) is a secondary amino compound (CHEBI:50995) |
| palbociclib (CHEBI:85993) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 6-acetyl-8-cyclopentyl-5-methyl-2-{[5-(piperazin-1-yl)pyridin-2-yl]amino}pyrido[2,3-d]pyrimidin-7(8H)-one |
| INN | Source |
|---|---|
| palbociclib | ChemIDplus |
| Synonyms | Source |
|---|---|
| 6-Acetyl-8-cyclopentyl-5-methyl-2-(5-piperazin-1-ylpyridin-2-ylamino)-8H-pyrido(2,3-d)pyrimidin-7-one | ChemIDplus |
| PD 0332991 | ChemIDplus |
| PD-0332991 | ChemIDplus |
| PD0332991 | ChemIDplus |
| PD 332991 | ChemIDplus |
| UNII-G9ZF61LE7G | ChemIDplus |
| Brand Name | Source |
|---|---|
| IBRANCE | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D10372 | KEGG DRUG |
| LQQ | PDBeChem |
| Palbociclib | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10219048 | Reaxys |
| CAS:571190-30-2 | ChemIDplus |
| CAS:571190-30-2 | KEGG DRUG |
| Citations |
|---|