EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H44O2 |
| Net Charge | 0 |
| Average Mass | 340.592 |
| Monoisotopic Mass | 340.33413 |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)OCCCC |
| InChI | InChI=1S/C22H44O2/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(23)24-21-6-4-2/h3-21H2,1-2H3 |
| InChIKey | ULBTUVJTXULMLP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) |
| Roles Classification |
|---|
| Biological Role: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butyl octadecanoate (CHEBI:85983) has functional parent octadecanoic acid (CHEBI:28842) |
| butyl octadecanoate (CHEBI:85983) has role algal metabolite (CHEBI:84735) |
| butyl octadecanoate (CHEBI:85983) is a fatty acid ester (CHEBI:35748) |
| IUPAC Name |
|---|
| butyl octadecanoate |
| Synonyms | Source |
|---|---|
| Butyl stearate | ChemIDplus |
| N-Butyl stearate | ChemIDplus |
| Butyl octadecylate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0040290 | HMDB |
| 1345 | PPDB |