EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10N3O6S.Na |
| Net Charge | 0 |
| Average Mass | 287.229 |
| Monoisotopic Mass | 287.01880 |
| SMILES | NC(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C7H11N3O6S.Na/c8-6(11)5-2-1-4-3-9(5)7(12)10(4)16-17(13,14)15;/h4-5H,1-3H2,(H2,8,11)(H,13,14,15);/q;+1/p-1/t4-,5+;/m1./s1 |
| InChIKey | RTCIKUMODPANKX-JBUOLDKXSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antibacterial drug A drug used to treat or prevent bacterial infections. EC 3.5.2.6 (beta-lactamase) inhibitor An EC 3.5.2.* (non-peptide cyclic amide C-N hydrolase) inhibitor that interferes with the action of β-lactamase (EC 3.5.2.6). |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| avibactam sodium (CHEBI:85982) has part avibactam(1−) (CHEBI:85988) |
| avibactam sodium (CHEBI:85982) has role antibacterial drug (CHEBI:36047) |
| avibactam sodium (CHEBI:85982) has role antimicrobial agent (CHEBI:33281) |
| avibactam sodium (CHEBI:85982) has role EC 3.5.2.6 (β-lactamase) inhibitor (CHEBI:35625) |
| avibactam sodium (CHEBI:85982) is a organic sodium salt (CHEBI:38700) |
| Incoming Relation(s) |
| Avycaz (CHEBI:85989) has part avibactam sodium (CHEBI:85982) |
| IUPAC Name |
|---|
| sodium ({[(2S,5R)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl]oxy}sulfonyl)oxidanide |
| Synonym | Source |
|---|---|
| NXL 104 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15577038 | Reaxys |
| CAS:1192491-61-4 | ChemIDplus |
| CAS:1192491-61-4 | KEGG DRUG |
| Citations |
|---|